About methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide
methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide (PubChem CID 139055816) has the molecular formula C15H18INO2
and a molecular weight of 371.22 g/mol. Its IUPAC name is methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide.
Molecular Properties
| Compound Name | methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide |
| PubChem CID | 139055816 |
| Molecular Formula | C15H18INO2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide |
| SMILES | CO.C[n+]1ccc(/C=C/c2ccccc2O)cc1.[I-] |
| InChI | InChI=1S/C14H13NO.CH4O.HI/c1-15-10-8-12(9-11-15)6-7-13-4-2-3-5-14(13)16;1-2;/h2-11H,1H3;2H,1H3;1H |
| InChIKey | MGYYUWCAKDOVGU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide?
The IUPAC name of methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide (CID 139055816) is methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide.
What is the SMILES notation for methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide?
The canonical SMILES for methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide is CO.C[n+]1ccc(/C=C/c2ccccc2O)cc1.[I-].
What is the InChIKey of methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide?
The InChIKey is MGYYUWCAKDOVGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO.CH4O.HI/c1-15-10-8-12(9-11-15)6-7-13-4-2-3-5-14(13)16;1-2;/h2-11H,1H3;2H,1H3;1H.
What are the key properties of methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide?
methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide has a molecular weight of 371.22 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide is sourced from PubChem (CID 139055816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).