About 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate
2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate (PubChem CID 139071802) has the molecular formula C15H18INO3
and a molecular weight of 387.22 g/mol. Its IUPAC name is 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate.
Molecular Properties
| Compound Name | 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate |
| PubChem CID | 139071802 |
| Molecular Formula | C15H18INO3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate |
| SMILES | COc1ccc(/C=C/c2cc[n+](C)cc2)cc1O.O.[I-] |
| InChI | InChI=1S/C15H15NO2.HI.H2O/c1-16-9-7-12(8-10-16)3-4-13-5-6-15(18-2)14(17)11-13;;/h3-11H,1-2H3;1H;1H2/b4-3+;; |
| InChIKey | AUYIWDRXFWHROB-CZEFNJPISA-N |
| XLogP | -1.42 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate?
The IUPAC name of 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate (CID 139071802) is 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate.
What is the SMILES notation for 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate?
The canonical SMILES for 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate is COc1ccc(/C=C/c2cc[n+](C)cc2)cc1O.O.[I-].
What is the InChIKey of 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate?
The InChIKey is AUYIWDRXFWHROB-CZEFNJPISA-N. The full InChI is InChI=1S/C15H15NO2.HI.H2O/c1-16-9-7-12(8-10-16)3-4-13-5-6-15(18-2)14(17)11-13;;/h3-11H,1-2H3;1H;1H2/b4-3+;;.
What are the key properties of 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate?
2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate has a molecular weight of 387.22 g/mol, XLogP of -1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol;iodide;hydrate is sourced from PubChem (CID 139071802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).