C33H37N2O3+ — CID 122209465
1-butyl-2-[2-(10-butylphenoxazin-3-yl)ethenyl]-3,3-dimethylindol-1-ium-5-carboxylic acid (PubChem CID 122209465) has the molecular formula C33H37N2O3+ and a molecular weight of 509.67 g/mol. Its IUPAC name is 1-butyl-2-[2-(10-butylphenoxazin-3-yl)ethenyl]-3,3-dimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 1-butyl-2-[2-(10-butylphenoxazin-3-yl)ethenyl]-3,3-dimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 122209465 |
| Molecular Formula | C33H37N2O3+ |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 1-butyl-2-[2-(10-butylphenoxazin-3-yl)ethenyl]-3,3-dimethylindol-1-ium-5-carboxylic acid |
| SMILES | CCCCN1c2ccccc2Oc2cc(C=CC3=[N+](CCCC)c4ccc(C(=O)O)cc4C3(C)C)ccc21 |
| InChI | InChI=1S/C33H36N2O3/c1-5-7-19-34-27-11-9-10-12-29(27)38-30-21-23(13-16-28(30)34)14-18-31-33(3,4)25-22-24(32(36)37)15-17-26(25)35(31)20-8-6-2/h9-18,21-22H,5-8,19-20H2,1-4H3/p+1 |
| InChIKey | GJMLKNMRVXUREG-UHFFFAOYSA-O |
| XLogP | 8.32 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|