C23H21ClNS+ — CID 74437754
1-(3-chloroprop-2-enyl)-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium (PubChem CID 74437754) has the molecular formula C23H21ClNS+ and a molecular weight of 378.95 g/mol. Its IUPAC name is 1-(3-chloroprop-2-enyl)-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium.
| Compound Name | 1-(3-chloroprop-2-enyl)-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 74437754 |
| Molecular Formula | C23H21ClNS+ |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(3-chloroprop-2-enyl)-1,3-dimethyl-2-(2-thiophen-2-ylethenyl)benzo[e]indol-3-ium |
| SMILES | C[N+]1=C(C=Cc2cccs2)C(C)(CC=CCl)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C23H21ClNS/c1-23(14-6-15-24)21(13-11-18-8-5-16-26-18)25(2)20-12-10-17-7-3-4-9-19(17)22(20)23/h3-13,15-16H,14H2,1-2H3/q+1 |
| InChIKey | JONWGZMXNUMVRI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|