C37H42F5N2+ — CID 76697671
4-[2-[3-(4-cyclopentylbutyl)-1-methyl-1-(1,1,2,3,3-pentafluoroprop-2-enyl)benzo[e]indol-3-ium-2-yl]ethenyl]-N,N-diethylaniline (PubChem CID 76697671) has the molecular formula C37H42F5N2+ and a molecular weight of 609.75 g/mol. Its IUPAC name is 4-[2-[3-(4-cyclopentylbutyl)-1-methyl-1-(1,1,2,3,3-pentafluoroprop-2-enyl)benzo[e]indol-3-ium-2-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2-[3-(4-cyclopentylbutyl)-1-methyl-1-(1,1,2,3,3-pentafluoroprop-2-enyl)benzo[e]indol-3-ium-2-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 76697671 |
| Molecular Formula | C37H42F5N2+ |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | 4-[2-[3-(4-cyclopentylbutyl)-1-methyl-1-(1,1,2,3,3-pentafluoroprop-2-enyl)benzo[e]indol-3-ium-2-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=CC2=[N+](CCCCC3CCCC3)c3ccc4ccccc4c3C2(C)C(F)(F)C(F)=C(F)F)cc1 |
| InChI | InChI=1S/C37H42F5N2/c1-4-43(5-2)29-21-17-27(18-22-29)19-24-32-36(3,37(41,42)34(38)35(39)40)33-30-16-9-8-15-28(30)20-23-31(33)44(32)25-11-10-14-26-12-6-7-13-26/h8-9,15-24,26H,4-7,10-14,25H2,1-3H3/q+1 |
| InChIKey | VEVXPIGSHYQWPV-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|