C34H44F3N2O2+ — CID 76697698
2-[2-[1-(4-cyclopentylbutyl)-3-methyl-3-prop-2-enyl-5-(trifluoromethoxy)indol-1-ium-2-yl]ethenyl]-5-(diethylamino)phenol (PubChem CID 76697698) has the molecular formula C34H44F3N2O2+ and a molecular weight of 569.73 g/mol. Its IUPAC name is 2-[2-[1-(4-cyclopentylbutyl)-3-methyl-3-prop-2-enyl-5-(trifluoromethoxy)indol-1-ium-2-yl]ethenyl]-5-(diethylamino)phenol.
| Compound Name | 2-[2-[1-(4-cyclopentylbutyl)-3-methyl-3-prop-2-enyl-5-(trifluoromethoxy)indol-1-ium-2-yl]ethenyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 76697698 |
| Molecular Formula | C34H44F3N2O2+ |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 2-[2-[1-(4-cyclopentylbutyl)-3-methyl-3-prop-2-enyl-5-(trifluoromethoxy)indol-1-ium-2-yl]ethenyl]-5-(diethylamino)phenol |
| SMILES | C=CCC1(C)C(C=Cc2ccc(N(CC)CC)cc2O)=[N+](CCCCC2CCCC2)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C34H43F3N2O2/c1-5-21-33(4)29-24-28(41-34(35,36)37)18-19-30(29)39(22-11-10-14-25-12-8-9-13-25)32(33)20-16-26-15-17-27(23-31(26)40)38(6-2)7-3/h5,15-20,23-25H,1,6-14,21-22H2,2-4H3/p+1 |
| InChIKey | PADRWDHTSLBMGJ-UHFFFAOYSA-O |
| XLogP | 9.14 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|