C26H35N2O+ — CID 58992086
3-ethoxy-N,N-diethyl-4-[(E)-2-(3-ethyl-1,3-dimethylindol-1-ium-2-yl)ethenyl]aniline (PubChem CID 58992086) has the molecular formula C26H35N2O+ and a molecular weight of 391.58 g/mol. Its IUPAC name is 3-ethoxy-N,N-diethyl-4-[(E)-2-(3-ethyl-1,3-dimethylindol-1-ium-2-yl)ethenyl]aniline.
| Compound Name | 3-ethoxy-N,N-diethyl-4-[(E)-2-(3-ethyl-1,3-dimethylindol-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 58992086 |
| Molecular Formula | C26H35N2O+ |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 3-ethoxy-N,N-diethyl-4-[(E)-2-(3-ethyl-1,3-dimethylindol-1-ium-2-yl)ethenyl]aniline |
| SMILES | CCOc1cc(N(CC)CC)ccc1/C=C/C1=[N+](C)c2ccccc2C1(C)CC |
| InChI | InChI=1S/C26H35N2O/c1-7-26(5)22-13-11-12-14-23(22)27(6)25(26)18-16-20-15-17-21(28(8-2)9-3)19-24(20)29-10-4/h11-19H,7-10H2,1-6H3/q+1 |
| InChIKey | QWGWOCMYOGKABE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|