C31H34F3IN2O — CID 161183623
N,N-diethyl-4-[(E)-2-[3-ethyl-3-methyl-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium-2-yl]ethenyl]-3-methoxyaniline iodide (PubChem CID 161183623) has the molecular formula C31H34F3IN2O and a molecular weight of 634.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-2-[3-ethyl-3-methyl-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium-2-yl]ethenyl]-3-methoxyaniline iodide.
| Compound Name | N,N-diethyl-4-[(E)-2-[3-ethyl-3-methyl-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium-2-yl]ethenyl]-3-methoxyaniline iodide |
|---|---|
| PubChem CID | 161183623 |
| Molecular Formula | C31H34F3IN2O |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | N,N-diethyl-4-[(E)-2-[3-ethyl-3-methyl-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium-2-yl]ethenyl]-3-methoxyaniline iodide |
| SMILES | CCN(CC)c1ccc(/C=C/C2=[N+](Cc3cc(F)c(F)c(F)c3)c3ccccc3C2(C)CC)c(OC)c1.[I-] |
| InChI | InChI=1S/C31H34F3N2O.HI/c1-6-31(4)24-11-9-10-12-27(24)36(20-21-17-25(32)30(34)26(33)18-21)29(31)16-14-22-13-15-23(19-28(22)37-5)35(7-2)8-3;/h9-19H,6-8,20H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | HWFYQPYWILTQEQ-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|