C24H29IN2O3 — CID 156902463
2-[2-[4-(diethylamino)-2-hydroxyphenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid iodide (PubChem CID 156902463) has the molecular formula C24H29IN2O3 and a molecular weight of 520.41 g/mol. Its IUPAC name is 2-[2-[4-(diethylamino)-2-hydroxyphenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid iodide.
| Compound Name | 2-[2-[4-(diethylamino)-2-hydroxyphenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid iodide |
|---|---|
| PubChem CID | 156902463 |
| Molecular Formula | C24H29IN2O3 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 2-[2-[4-(diethylamino)-2-hydroxyphenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid iodide |
| SMILES | CCN(CC)c1ccc(C=CC2=[N+](C)c3ccc(C(=O)O)cc3C2(C)C)c(O)c1.[I-] |
| InChI | InChI=1S/C24H28N2O3.HI/c1-6-26(7-2)18-11-8-16(21(27)15-18)10-13-22-24(3,4)19-14-17(23(28)29)9-12-20(19)25(22)5;/h8-15H,6-7H2,1-5H3,(H,28,29);1H |
| InChIKey | DJJWZWAADJJIHW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|