C24H29N2O3+ — CID 23390578
3-[N-ethyl-3-hydroxy-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]anilino]propanoic acid (PubChem CID 23390578) has the molecular formula C24H29N2O3+ and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-[N-ethyl-3-hydroxy-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]anilino]propanoic acid.
| Compound Name | 3-[N-ethyl-3-hydroxy-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 23390578 |
| Molecular Formula | C24H29N2O3+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-[N-ethyl-3-hydroxy-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]anilino]propanoic acid |
| SMILES | CCN(CCC(=O)O)c1ccc(/C=C/C2=[N+](C)c3ccccc3C2(C)C)c(O)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-5-26(15-14-23(28)29)18-12-10-17(21(27)16-18)11-13-22-24(2,3)19-8-6-7-9-20(19)25(22)4/h6-13,16H,5,14-15H2,1-4H3,(H,28,29)/p+1 |
| InChIKey | FUQNMNRSNNEGMH-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|