C31H37N2O4+ — CID 175678563
6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid (PubChem CID 175678563) has the molecular formula C31H37N2O4+ and a molecular weight of 501.65 g/mol. Its IUPAC name is 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 175678563 |
| Molecular Formula | C31H37N2O4+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
| SMILES | CCN(CC)c1ccc2cc(/C=C/C3=[N+](CCCCCC(=O)O)c4ccccc4C3(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C31H36N2O4/c1-5-32(6-2)24-17-15-22-20-23(30(36)37-27(22)21-24)16-18-28-31(3,4)25-12-9-10-13-26(25)33(28)19-11-7-8-14-29(34)35/h9-10,12-13,15-18,20-21H,5-8,11,14,19H2,1-4H3/p+1 |
| InChIKey | GMVLPTYFYUJNTK-UHFFFAOYSA-O |
| XLogP | 6.37 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|