C31H42N3O9S+ — CID 86589117
carboxymethyl(trimethyl)azanium;1-(5-carboxypentyl)-6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-3-sulfonate (PubChem CID 86589117) has the molecular formula C31H42N3O9S+ and a molecular weight of 632.76 g/mol. Its IUPAC name is carboxymethyl(trimethyl)azanium;1-(5-carboxypentyl)-6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-3-sulfonate.
| Compound Name | carboxymethyl(trimethyl)azanium;1-(5-carboxypentyl)-6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-3-sulfonate |
|---|---|
| PubChem CID | 86589117 |
| Molecular Formula | C31H42N3O9S+ |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | carboxymethyl(trimethyl)azanium;1-(5-carboxypentyl)-6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-3-sulfonate |
| SMILES | CCN(CC)c1ccc2cc(/C=C/c3ccc(S(=O)(=O)[O-])c[n+]3CCCCCC(=O)O)c(=O)oc2c1.C[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C26H30N2O7S.C5H11NO2/c1-3-27(4-2)22-12-9-19-16-20(26(31)35-24(19)17-22)10-11-21-13-14-23(36(32,33)34)18-28(21)15-7-5-6-8-25(29)30;1-6(2,3)4-5(7)8/h9-14,16-18H,3-8,15H2,1-2H3,(H-,29,30,32,33,34);4H2,1-3H3/p+1 |
| InChIKey | GRTQEXKMWCFLIP-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|