C31H35BrN2O4 — CID 173237871
6-[2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-8-methylquinolin-1-ium-1-yl]hexanoic acid bromide (PubChem CID 173237871) has the molecular formula C31H35BrN2O4 and a molecular weight of 579.54 g/mol. Its IUPAC name is 6-[2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-8-methylquinolin-1-ium-1-yl]hexanoic acid bromide.
| Compound Name | 6-[2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-8-methylquinolin-1-ium-1-yl]hexanoic acid bromide |
|---|---|
| PubChem CID | 173237871 |
| Molecular Formula | C31H35BrN2O4 |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 6-[2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-8-methylquinolin-1-ium-1-yl]hexanoic acid bromide |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3ccc4cccc(C)c4[n+]3CCCCCC(=O)O)c(=O)oc2c1.[Br-] |
| InChI | InChI=1S/C31H34N2O4.BrH/c1-4-32(5-2)27-18-14-24-20-25(31(36)37-28(24)21-27)15-17-26-16-13-23-11-9-10-22(3)30(23)33(26)19-8-6-7-12-29(34)35;/h9-11,13-18,20-21H,4-8,12,19H2,1-3H3;1H |
| InChIKey | ZUAYYCXBULNOCK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|