C34H48N3O7S+ — CID 170959769
methyl 6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(3-methylbutoxy)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonate (PubChem CID 170959769) has the molecular formula C34H48N3O7S+ and a molecular weight of 642.84 g/mol. Its IUPAC name is methyl 6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(3-methylbutoxy)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonate.
| Compound Name | methyl 6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(3-methylbutoxy)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonate |
|---|---|
| PubChem CID | 170959769 |
| Molecular Formula | C34H48N3O7S+ |
| Molecular Weight | 642.84 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | methyl 6-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(3-methylbutoxy)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonate |
| SMILES | CCN(CC)c1ccc2cc(/C=C/c3ccc(S(=O)(=O)OC)c[n+]3CCCCCC(=O)NCCOCCC(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C34H47N3O7S/c1-6-36(7-2)30-15-12-27-23-28(34(39)44-32(27)24-30)13-14-29-16-17-31(45(40,41)42-5)25-37(29)20-10-8-9-11-33(38)35-19-22-43-21-18-26(3)4/h12-17,23-26H,6-11,18-22H2,1-5H3/p+1 |
| InChIKey | UKEOGKQMQURTEE-UHFFFAOYSA-O |
| XLogP | 5.17 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|