C22H22N2O5P+ — CID 123893141
2-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-5-phosphorosopyridin-1-ium-1-yl]acetic acid (PubChem CID 123893141) has the molecular formula C22H22N2O5P+ and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-5-phosphorosopyridin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-5-phosphorosopyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 123893141 |
| Molecular Formula | C22H22N2O5P+ |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-5-phosphorosopyridin-1-ium-1-yl]acetic acid |
| SMILES | CCN(CC)c1ccc2cc(/C=C/c3ccc(P=O)c[n+]3CC(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C22H21N2O5P/c1-3-23(4-2)18-8-5-15-11-16(22(27)29-20(15)12-18)6-7-17-9-10-19(30-28)13-24(17)14-21(25)26/h5-13H,3-4,14H2,1-2H3/p+1 |
| InChIKey | HZMIYTWLWOUZFD-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|