C32H37N4O8S+ — CID 102162945
6-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonic acid (PubChem CID 102162945) has the molecular formula C32H37N4O8S+ and a molecular weight of 637.74 g/mol. Its IUPAC name is 6-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonic acid.
| Compound Name | 6-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonic acid |
|---|---|
| PubChem CID | 102162945 |
| Molecular Formula | C32H37N4O8S+ |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 6-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]pyridin-1-ium-3-sulfonic acid |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3ccc(S(=O)(=O)O)c[n+]3CCCCCC(=O)NCCN3C(=O)C=CC3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C32H36N4O8S/c1-3-34(4-2)26-12-9-23-20-24(32(40)44-28(23)21-26)10-11-25-13-14-27(45(41,42)43)22-35(25)18-7-5-6-8-29(37)33-17-19-36-30(38)15-16-31(36)39/h9-16,20-22H,3-8,17-19H2,1-2H3,(H-,33,37,41,42,43)/p+1 |
| InChIKey | BGCLDRGNZCOAQK-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|