C26H30BrN2O4+ — CID 72530932
6-[5-bromo-2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 72530932) has the molecular formula C26H30BrN2O4+ and a molecular weight of 514.44 g/mol. Its IUPAC name is 6-[5-bromo-2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[5-bromo-2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 72530932 |
| Molecular Formula | C26H30BrN2O4+ |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 6-[5-bromo-2-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3ccc(Br)c[n+]3CCCCCC(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C26H29BrN2O4/c1-3-28(4-2)23-13-9-19-16-20(26(32)33-24(19)17-23)10-12-22-14-11-21(27)18-29(22)15-7-5-6-8-25(30)31/h9-14,16-18H,3-8,15H2,1-2H3/p+1 |
| InChIKey | LBDVVGLXVPKGJJ-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|