C50H59N4O5+ — CID 52944257
[3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]phenyl] 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate (PubChem CID 52944257) has the molecular formula C50H59N4O5+ and a molecular weight of 796.05 g/mol. Its IUPAC name is [3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]phenyl] 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate.
| Compound Name | [3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]phenyl] 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate |
|---|---|
| PubChem CID | 52944257 |
| Molecular Formula | C50H59N4O5+ |
| Molecular Weight | 796.05 g/mol |
| Exact Mass | 795.45 |
| IUPAC Name | [3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]phenyl] 6-[2-[(E)-2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoate |
| SMILES | CCN(CC)c1ccc2cc(/C=C/C3=[N+](CCCCCC(=O)Oc4cccc(CCN5CCN(c6ccccc6OC)CC5)c4)c4ccccc4C3(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C50H59N4O5/c1-6-52(7-2)40-25-23-38-35-39(49(56)59-46(38)36-40)24-26-47-50(3,4)42-18-10-11-19-43(42)54(47)28-14-8-9-22-48(55)58-41-17-15-16-37(34-41)27-29-51-30-32-53(33-31-51)44-20-12-13-21-45(44)57-5/h10-13,15-21,23-26,34-36H,6-9,14,22,27-33H2,1-5H3/q+1 |
| InChIKey | VADVHCUUMVARLM-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.05 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|