C24H29N3O4 — CID 57420171
(2-oxo-3,4-dihydro-1H-quinolin-7-yl) 4-[4-(2-methoxyphenyl)piperazin-1-yl]butanoate (PubChem CID 57420171) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 4-[4-(2-methoxyphenyl)piperazin-1-yl]butanoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 4-[4-(2-methoxyphenyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 57420171 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-7-yl) 4-[4-(2-methoxyphenyl)piperazin-1-yl]butanoate |
| SMILES | COc1ccccc1N1CCN(CCCC(=O)Oc2ccc3c(c2)NC(=O)CC3)CC1 |
| InChI | InChI=1S/C24H29N3O4/c1-30-22-6-3-2-5-21(22)27-15-13-26(14-16-27)12-4-7-24(29)31-19-10-8-18-9-11-23(28)25-20(18)17-19/h2-3,5-6,8,10,17H,4,7,9,11-16H2,1H3,(H,25,28) |
| InChIKey | NVNMFROQWZTJRL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|