C30H40N4O6 — CID 68570533
3-methyl-2-[[2-[2-[4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butyl]piperazin-1-yl]phenoxy]acetyl]amino]butanoic acid (PubChem CID 68570533) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is 3-methyl-2-[[2-[2-[4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butyl]piperazin-1-yl]phenoxy]acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-[2-[4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butyl]piperazin-1-yl]phenoxy]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 68570533 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 3-methyl-2-[[2-[2-[4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butyl]piperazin-1-yl]phenoxy]acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)COc1ccccc1N1CCN(CCCCOc2ccc3c(c2)NC(=O)CC3)CC1)C(=O)O |
| InChI | InChI=1S/C30H40N4O6/c1-21(2)29(30(37)38)32-28(36)20-40-26-8-4-3-7-25(26)34-16-14-33(15-17-34)13-5-6-18-39-23-11-9-22-10-12-27(35)31-24(22)19-23/h3-4,7-9,11,19,21,29H,5-6,10,12-18,20H2,1-2H3,(H,31,35)(H,32,36)(H,37,38) |
| InChIKey | QPXXPCDZHNOAJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|