C27H26NO5S+ — CID 123729160
4-[2-[2-(7-ethynyl-2-oxochromen-3-yl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 123729160) has the molecular formula C27H26NO5S+ and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-[2-[2-(7-ethynyl-2-oxochromen-3-yl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-(7-ethynyl-2-oxochromen-3-yl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 123729160 |
| Molecular Formula | C27H26NO5S+ |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-[2-[2-(7-ethynyl-2-oxochromen-3-yl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | C#Cc1ccc2cc(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccccc4C3(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C27H25NO5S/c1-4-19-11-12-20-18-21(26(29)33-24(20)17-19)13-14-25-27(2,3)22-9-5-6-10-23(22)28(25)15-7-8-16-34(30,31)32/h1,5-6,9-14,17-18H,7-8,15-16H2,2-3H3/p+1 |
| InChIKey | QWLMWTDJZDKZHG-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 87.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|