C31H30NO5S+ — CID 118334661
4-[3,3-dimethyl-2-[(E)-2-[(8Z)-2-oxo-10,11-didehydro-6,7-dihydrocycloocta[g]chromen-3-yl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 118334661) has the molecular formula C31H30NO5S+ and a molecular weight of 528.65 g/mol. Its IUPAC name is 4-[3,3-dimethyl-2-[(E)-2-[(8Z)-2-oxo-10,11-didehydro-6,7-dihydrocycloocta[g]chromen-3-yl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[3,3-dimethyl-2-[(E)-2-[(8Z)-2-oxo-10,11-didehydro-6,7-dihydrocycloocta[g]chromen-3-yl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 118334661 |
| Molecular Formula | C31H30NO5S+ |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 4-[3,3-dimethyl-2-[(E)-2-[(8Z)-2-oxo-10,11-didehydro-6,7-dihydrocycloocta[g]chromen-3-yl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CC1(C)C(/C=C/c2cc3cc4c(cc3oc2=O)C#C/C=C\CC4)=[N+](CCCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C31H29NO5S/c1-31(2)26-13-7-8-14-27(26)32(17-9-10-18-38(34,35)36)29(31)16-15-24-20-25-19-22-11-5-3-4-6-12-23(22)21-28(25)37-30(24)33/h3-4,7-8,13-16,19-21H,5,9-11,17-18H2,1-2H3/p+1/b4-3-,16-15+ |
| InChIKey | CGPJQBMMWYSZPZ-MLOLRHNGSA-O |
| XLogP | 5.40 |
| TPSA | 87.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|