C28H36N3O3S+ — CID 167693590
4-[5-amino-2-[(E,3Z)-3-(5-amino-3,3-dimethyl-1H-inden-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 167693590) has the molecular formula C28H36N3O3S+ and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-[5-amino-2-[(E,3Z)-3-(5-amino-3,3-dimethyl-1H-inden-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-amino-2-[(E,3Z)-3-(5-amino-3,3-dimethyl-1H-inden-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 167693590 |
| Molecular Formula | C28H36N3O3S+ |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 4-[5-amino-2-[(E,3Z)-3-(5-amino-3,3-dimethyl-1H-inden-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CC1(C)C(/C=C/C=C2/Cc3ccc(N)cc3C2(C)C)=[N+](CCCCS(=O)(=O)O)c2ccc(N)cc21 |
| InChI | InChI=1S/C28H35N3O3S/c1-27(2)20(16-19-10-11-21(29)17-23(19)27)8-7-9-26-28(3,4)24-18-22(30)12-13-25(24)31(26)14-5-6-15-35(32,33)34/h7-13,17-18H,5-6,14-16,29-30H2,1-4H3/p+1/b9-7+,20-8- |
| InChIKey | OZQOCSNPQLFEDO-FVHOXEJOSA-O |
| XLogP | 4.91 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|