C29H34ClN2O6S2+ — CID 76652552
2-[5-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1H-indole-5-sulfonic acid (PubChem CID 76652552) has the molecular formula C29H34ClN2O6S2+ and a molecular weight of 606.19 g/mol. Its IUPAC name is 2-[5-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1H-indole-5-sulfonic acid.
| Compound Name | 2-[5-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 76652552 |
| Molecular Formula | C29H34ClN2O6S2+ |
| Molecular Weight | 606.19 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 2-[5-[5-chloro-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-1H-indole-5-sulfonic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCCS(=O)(=O)O)c3ccc(Cl)cc3C2(C)C)Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C29H33ClN2O6S2/c1-28(2)22-19-21(40(36,37)38)13-14-24(22)31-26(28)10-6-5-7-11-27-29(3,4)23-18-20(30)12-15-25(23)32(27)16-8-9-17-39(33,34)35/h5-7,10-15,18-19H,8-9,16-17H2,1-4H3,(H2,33,34,35,36,37,38)/p+1 |
| InChIKey | BNMOIFPBCYYWBT-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.19 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|