C25H29N2O7S2+ — CID 75213196
2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 75213196) has the molecular formula C25H29N2O7S2+ and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 75213196 |
| Molecular Formula | C25H29N2O7S2+ |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC(=O)N(C=CC=CC1=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O7S2/c1-19(28)26(20-10-5-4-6-11-20)15-8-7-12-24-25(2,3)22-18-21(36(32,33)34)13-14-23(22)27(24)16-9-17-35(29,30)31/h4-8,10-15,18H,9,16-17H2,1-3H3,(H-,29,30,31,32,33,34)/p+1 |
| InChIKey | GTSTVPDERWJVLH-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|