C31H31N2O9S2+ — CID 123298654
4-[[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3-methyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-3-yl]methyl]benzoic acid (PubChem CID 123298654) has the molecular formula C31H31N2O9S2+ and a molecular weight of 639.73 g/mol. Its IUPAC name is 4-[[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3-methyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3-methyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 123298654 |
| Molecular Formula | C31H31N2O9S2+ |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 4-[[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3-methyl-5-sulfo-1-(2-sulfoethyl)indol-1-ium-3-yl]methyl]benzoic acid |
| SMILES | CC(=O)N(C=CC=CC1=[N+](CCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)Cc1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O9S2/c1-22(34)32(25-8-4-3-5-9-25)17-7-6-10-29-31(2,21-23-11-13-24(14-12-23)30(35)36)27-20-26(44(40,41)42)15-16-28(27)33(29)18-19-43(37,38)39/h3-17,20H,18-19,21H2,1-2H3,(H2-,35,36,37,38,39,40,41,42)/p+1 |
| InChIKey | QKESJZPDVAREQY-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|