C33H37N2O9S2+ — CID 144616737
[2-[(4E,6E)-7-(N-acetylanilino)-1-(4-carboxyphenyl)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-sulfophenyl]-(3-sulfopropyl)azanium (PubChem CID 144616737) has the molecular formula C33H37N2O9S2+ and a molecular weight of 669.80 g/mol. Its IUPAC name is [2-[(4E,6E)-7-(N-acetylanilino)-1-(4-carboxyphenyl)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-sulfophenyl]-(3-sulfopropyl)azanium.
| Compound Name | [2-[(4E,6E)-7-(N-acetylanilino)-1-(4-carboxyphenyl)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-sulfophenyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 144616737 |
| Molecular Formula | C33H37N2O9S2+ |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | [2-[(4E,6E)-7-(N-acetylanilino)-1-(4-carboxyphenyl)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-sulfophenyl]-(3-sulfopropyl)azanium |
| SMILES | C=C(/C=C/C=C/N(C(C)=O)c1ccccc1)C(C)(Cc1ccc(C(=O)O)cc1)c1cc(S(=O)(=O)O)ccc1[NH2+]CCCS(=O)(=O)O |
| InChI | InChI=1S/C33H36N2O9S2/c1-24(10-7-8-20-35(25(2)36)28-11-5-4-6-12-28)33(3,23-26-13-15-27(16-14-26)32(37)38)30-22-29(46(42,43)44)17-18-31(30)34-19-9-21-45(39,40)41/h4-8,10-18,20,22,34H,1,9,19,21,23H2,2-3H3,(H,37,38)(H,39,40,41)(H,42,43,44)/p+1/b10-7+,20-8+ |
| InChIKey | UWEKZAPWVLROOR-KEINTQJTSA-O |
| XLogP | 4.28 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|