C37H41N2O8S2+ — CID 177490381
4-[[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]methyl]benzoic acid (PubChem CID 177490381) has the molecular formula C37H41N2O8S2+ and a molecular weight of 705.88 g/mol. Its IUPAC name is 4-[[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 177490381 |
| Molecular Formula | C37H41N2O8S2+ |
| Molecular Weight | 705.88 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | 4-[[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]methyl]benzoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)=[N+](Cc2ccc(C(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C37H40N2O8S2/c1-36(2)29-12-8-9-13-31(29)39(25-26-16-18-27(19-17-26)35(40)41)34(36)15-7-5-6-14-33-37(3,4)30-24-28(49(45,46)47)20-21-32(30)38(33)22-10-11-23-48(42,43)44/h5-9,12-21,24H,10-11,22-23,25H2,1-4H3,(H2-,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | ARCHELJMSHLVLM-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|