C31H41NO10S3 — CID 90397155
(2E)-1-ethyl-3-(2-methoxyethyl)-3-methyl-2-[(E)-5-methyl-4-methylidene-5-(2-methyl-5-sulfophenyl)-8-sulfooct-2-enylidene]indole-5-sulfonic acid (PubChem CID 90397155) has the molecular formula C31H41NO10S3 and a molecular weight of 683.87 g/mol. Its IUPAC name is (2E)-1-ethyl-3-(2-methoxyethyl)-3-methyl-2-[(E)-5-methyl-4-methylidene-5-(2-methyl-5-sulfophenyl)-8-sulfooct-2-enylidene]indole-5-sulfonic acid.
| Compound Name | (2E)-1-ethyl-3-(2-methoxyethyl)-3-methyl-2-[(E)-5-methyl-4-methylidene-5-(2-methyl-5-sulfophenyl)-8-sulfooct-2-enylidene]indole-5-sulfonic acid |
|---|---|
| PubChem CID | 90397155 |
| Molecular Formula | C31H41NO10S3 |
| Molecular Weight | 683.87 g/mol |
| Exact Mass | 683.19 |
| IUPAC Name | (2E)-1-ethyl-3-(2-methoxyethyl)-3-methyl-2-[(E)-5-methyl-4-methylidene-5-(2-methyl-5-sulfophenyl)-8-sulfooct-2-enylidene]indole-5-sulfonic acid |
| SMILES | C=C(/C=C/C=C1/N(CC)c2ccc(S(=O)(=O)O)cc2C1(C)CCOC)C(C)(CCCS(=O)(=O)O)c1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C31H41NO10S3/c1-7-32-28-15-14-25(45(39,40)41)21-27(28)31(5,17-18-42-6)29(32)11-8-10-23(3)30(4,16-9-19-43(33,34)35)26-20-24(44(36,37)38)13-12-22(26)2/h8,10-15,20-21H,3,7,9,16-19H2,1-2,4-6H3,(H,33,34,35)(H,36,37,38)(H,39,40,41)/b10-8+,29-11+ |
| InChIKey | OMUHWQQKANSATJ-BOGJHBCMSA-N |
| XLogP | 5.24 |
| TPSA | 175.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|