C30H38N2O13S4 — CID 88564648
(2E)-1-(2-methoxyethyl)-3-methyl-2-[(E)-3-[3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-yl]prop-2-enylidene]-3-(3-sulfopropyl)indole-5-sulfonic acid (PubChem CID 88564648) has the molecular formula C30H38N2O13S4 and a molecular weight of 762.90 g/mol. Its IUPAC name is (2E)-1-(2-methoxyethyl)-3-methyl-2-[(E)-3-[3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-yl]prop-2-enylidene]-3-(3-sulfopropyl)indole-5-sulfonic acid.
| Compound Name | (2E)-1-(2-methoxyethyl)-3-methyl-2-[(E)-3-[3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-yl]prop-2-enylidene]-3-(3-sulfopropyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 88564648 |
| Molecular Formula | C30H38N2O13S4 |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.13 |
| IUPAC Name | (2E)-1-(2-methoxyethyl)-3-methyl-2-[(E)-3-[3-methyl-5-sulfo-3-(3-sulfopropyl)indol-2-yl]prop-2-enylidene]-3-(3-sulfopropyl)indole-5-sulfonic acid |
| SMILES | COCCN1/C(=C/C=C/C2=Nc3ccc(S(=O)(=O)O)cc3C2(C)CCCS(=O)(=O)O)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C30H38N2O13S4/c1-29(13-5-17-46(33,34)35)23-19-21(48(39,40)41)9-11-25(23)31-27(29)7-4-8-28-30(2,14-6-18-47(36,37)38)24-20-22(49(42,43)44)10-12-26(24)32(28)15-16-45-3/h4,7-12,19-20H,5-6,13-18H2,1-3H3,(H,33,34,35)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b7-4+,28-8+ |
| InChIKey | DVJLAWBTSOGKCU-AQSHFKEFSA-N |
| XLogP | 3.72 |
| TPSA | 242.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|