C35H49NO11S3 — CID 90397159
(2E)-1-(2-methoxyethyl)-2-[(E)-5-[5-(2-methoxyethyl)-2-methylphenyl]-5-methyl-4-methylidene-8-sulfooct-2-enylidene]-3-methyl-3-(3-sulfopropyl)indole-5-sulfonic acid (PubChem CID 90397159) has the molecular formula C35H49NO11S3 and a molecular weight of 755.97 g/mol. Its IUPAC name is (2E)-1-(2-methoxyethyl)-2-[(E)-5-[5-(2-methoxyethyl)-2-methylphenyl]-5-methyl-4-methylidene-8-sulfooct-2-enylidene]-3-methyl-3-(3-sulfopropyl)indole-5-sulfonic acid.
| Compound Name | (2E)-1-(2-methoxyethyl)-2-[(E)-5-[5-(2-methoxyethyl)-2-methylphenyl]-5-methyl-4-methylidene-8-sulfooct-2-enylidene]-3-methyl-3-(3-sulfopropyl)indole-5-sulfonic acid |
|---|---|
| PubChem CID | 90397159 |
| Molecular Formula | C35H49NO11S3 |
| Molecular Weight | 755.97 g/mol |
| Exact Mass | 755.25 |
| IUPAC Name | (2E)-1-(2-methoxyethyl)-2-[(E)-5-[5-(2-methoxyethyl)-2-methylphenyl]-5-methyl-4-methylidene-8-sulfooct-2-enylidene]-3-methyl-3-(3-sulfopropyl)indole-5-sulfonic acid |
| SMILES | C=C(/C=C/C=C1/N(CCOC)c2ccc(S(=O)(=O)O)cc2C1(C)CCCS(=O)(=O)O)C(C)(CCCS(=O)(=O)O)c1cc(CCOC)ccc1C |
| InChI | InChI=1S/C35H49NO11S3/c1-26-12-13-28(16-20-46-5)24-30(26)34(3,17-8-22-48(37,38)39)27(2)10-7-11-33-35(4,18-9-23-49(40,41)42)31-25-29(50(43,44)45)14-15-32(31)36(33)19-21-47-6/h7,10-15,24-25H,2,8-9,16-23H2,1,3-6H3,(H,37,38,39)(H,40,41,42)(H,43,44,45)/b10-7+,33-11+ |
| InChIKey | NYWIYJAUDMHWQE-VKPRTABESA-N |
| XLogP | 5.44 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|