C30H37N2O5S- — CID 129078494
3-[(4E,6E)-7-(N-acetylanilino)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-[5-carboxypentyl(methyl)amino]benzenesulfinate (PubChem CID 129078494) has the molecular formula C30H37N2O5S- and a molecular weight of 537.70 g/mol. Its IUPAC name is 3-[(4E,6E)-7-(N-acetylanilino)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-[5-carboxypentyl(methyl)amino]benzenesulfinate.
| Compound Name | 3-[(4E,6E)-7-(N-acetylanilino)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-[5-carboxypentyl(methyl)amino]benzenesulfinate |
|---|---|
| PubChem CID | 129078494 |
| Molecular Formula | C30H37N2O5S- |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 3-[(4E,6E)-7-(N-acetylanilino)-2-methyl-3-methylidenehepta-4,6-dien-2-yl]-4-[5-carboxypentyl(methyl)amino]benzenesulfinate |
| SMILES | C=C(/C=C/C=C/N(C(C)=O)c1ccccc1)C(C)(C)c1cc(S(=O)[O-])ccc1N(C)CCCCCC(=O)O |
| InChI | InChI=1S/C30H38N2O5S/c1-23(14-11-13-21-32(24(2)33)25-15-8-6-9-16-25)30(3,4)27-22-26(38(36)37)18-19-28(27)31(5)20-12-7-10-17-29(34)35/h6,8-9,11,13-16,18-19,21-22H,1,7,10,12,17,20H2,2-5H3,(H,34,35)(H,36,37)/p-1/b14-11+,21-13+ |
| InChIKey | GMKMGYNVGGOITP-WWYKEHLISA-M |
| XLogP | 5.96 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|