C18H29NO5S — CID 123137893
6-[N-methyl-2-(2-methylbutan-2-yl)-4-sulfoanilino]hexanoic acid (PubChem CID 123137893) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is 6-[N-methyl-2-(2-methylbutan-2-yl)-4-sulfoanilino]hexanoic acid.
| Compound Name | 6-[N-methyl-2-(2-methylbutan-2-yl)-4-sulfoanilino]hexanoic acid |
|---|---|
| PubChem CID | 123137893 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 6-[N-methyl-2-(2-methylbutan-2-yl)-4-sulfoanilino]hexanoic acid |
| SMILES | CCC(C)(C)c1cc(S(=O)(=O)O)ccc1N(C)CCCCCC(=O)O |
| InChI | InChI=1S/C18H29NO5S/c1-5-18(2,3)15-13-14(25(22,23)24)10-11-16(15)19(4)12-8-6-7-9-17(20)21/h10-11,13H,5-9,12H2,1-4H3,(H,20,21)(H,22,23,24) |
| InChIKey | LFPGTAYLJQDSJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|