C20H32N2O5S — CID 166922498
6-[[4-(dipropylsulfamoyl)benzoyl]-methylamino]hexanoic acid (PubChem CID 166922498) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is 6-[[4-(dipropylsulfamoyl)benzoyl]-methylamino]hexanoic acid.
| Compound Name | 6-[[4-(dipropylsulfamoyl)benzoyl]-methylamino]hexanoic acid |
|---|---|
| PubChem CID | 166922498 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 6-[[4-(dipropylsulfamoyl)benzoyl]-methylamino]hexanoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)N(C)CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C20H32N2O5S/c1-4-14-22(15-5-2)28(26,27)18-12-10-17(11-13-18)20(25)21(3)16-8-6-7-9-19(23)24/h10-13H,4-9,14-16H2,1-3H3,(H,23,24) |
| InChIKey | MQNUPQWWTYOEQO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|