C29H29N2O3S+ — CID 138600443
methyl 2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-phenylindol-1-ium-5-sulfinate (PubChem CID 138600443) has the molecular formula C29H29N2O3S+ and a molecular weight of 485.63 g/mol. Its IUPAC name is methyl 2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-phenylindol-1-ium-5-sulfinate.
| Compound Name | methyl 2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-phenylindol-1-ium-5-sulfinate |
|---|---|
| PubChem CID | 138600443 |
| Molecular Formula | C29H29N2O3S+ |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | methyl 2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-1-phenylindol-1-ium-5-sulfinate |
| SMILES | COS(=O)c1ccc2c(c1)C(C)(C)C(/C=C/C=C/N(C(C)=O)c1ccccc1)=[N+]2c1ccccc1 |
| InChI | InChI=1S/C29H29N2O3S/c1-22(32)30(23-13-7-5-8-14-23)20-12-11-17-28-29(2,3)26-21-25(35(33)34-4)18-19-27(26)31(28)24-15-9-6-10-16-24/h5-21H,1-4H3/q+1 |
| InChIKey | RSJARKNRCNSWOU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|