C33H41N2O3+ — CID 172539349
ethyl 6-[2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-1-but-3-enyl-3-methylindol-1-ium-3-yl]hexanoate (PubChem CID 172539349) has the molecular formula C33H41N2O3+ and a molecular weight of 513.70 g/mol. Its IUPAC name is ethyl 6-[2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-1-but-3-enyl-3-methylindol-1-ium-3-yl]hexanoate.
| Compound Name | ethyl 6-[2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-1-but-3-enyl-3-methylindol-1-ium-3-yl]hexanoate |
|---|---|
| PubChem CID | 172539349 |
| Molecular Formula | C33H41N2O3+ |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | ethyl 6-[2-[(1E,3E)-4-(N-acetylanilino)buta-1,3-dienyl]-1-but-3-enyl-3-methylindol-1-ium-3-yl]hexanoate |
| SMILES | C=CCC[N+]1=C(/C=C/C=C/N(C(C)=O)c2ccccc2)C(C)(CCCCCC(=O)OCC)c2ccccc21 |
| InChI | InChI=1S/C33H41N2O3/c1-5-7-25-35-30-21-14-13-20-29(30)33(4,24-16-9-12-23-32(37)38-6-2)31(35)22-15-17-26-34(27(3)36)28-18-10-8-11-19-28/h5,8,10-11,13-15,17-22,26H,1,6-7,9,12,16,23-25H2,2-4H3/q+1 |
| InChIKey | MHXWOQNOQMPVBT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|