C17H22INO2 — CID 25119503
5-(1-ethenyl-2,3-dimethylindol-1-ium-3-yl)pentanoic acid iodide (PubChem CID 25119503) has the molecular formula C17H22INO2 and a molecular weight of 399.27 g/mol. Its IUPAC name is 5-(1-ethenyl-2,3-dimethylindol-1-ium-3-yl)pentanoic acid iodide.
| Compound Name | 5-(1-ethenyl-2,3-dimethylindol-1-ium-3-yl)pentanoic acid iodide |
|---|---|
| PubChem CID | 25119503 |
| Molecular Formula | C17H22INO2 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-(1-ethenyl-2,3-dimethylindol-1-ium-3-yl)pentanoic acid iodide |
| SMILES | C=C[N+]1=C(C)C(C)(CCCCC(=O)O)c2ccccc21.[I-] |
| InChI | InChI=1S/C17H21NO2.HI/c1-4-18-13(2)17(3,12-8-7-11-16(19)20)14-9-5-6-10-15(14)18;/h4-6,9-10H,1,7-8,11-12H2,2-3H3;1H |
| InChIKey | RAIHEMMMMXFCKO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|