About pentanedioic acid;toluene
pentanedioic acid;toluene (PubChem CID 159822689) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is pentanedioic acid;toluene.
Molecular Properties
| Compound Name | pentanedioic acid;toluene |
| PubChem CID | 159822689 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | pentanedioic acid;toluene |
| SMILES | Cc1ccccc1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C7H8.C5H8O4/c1-7-5-3-2-4-6-7;6-4(7)2-1-3-5(8)9/h2-6H,1H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | NMLFDZFDUJTUHN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentanedioic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanedioic acid;toluene?
The IUPAC name of pentanedioic acid;toluene (CID 159822689) is pentanedioic acid;toluene.
What is the SMILES notation for pentanedioic acid;toluene?
The canonical SMILES for pentanedioic acid;toluene is Cc1ccccc1.O=C(O)CCCC(=O)O.
What is the InChIKey of pentanedioic acid;toluene?
The InChIKey is NMLFDZFDUJTUHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C5H8O4/c1-7-5-3-2-4-6-7;6-4(7)2-1-3-5(8)9/h2-6H,1H3;1-3H2,(H,6,7)(H,8,9).
What are the key properties of pentanedioic acid;toluene?
pentanedioic acid;toluene has a molecular weight of 224.26 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentanedioic acid;toluene is sourced from PubChem (CID 159822689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).