About toluene;2-tritiopropanoic acid
toluene;2-tritiopropanoic acid (PubChem CID 161222842) has the molecular formula C10H14O2
and a molecular weight of 168.23 g/mol. Its IUPAC name is toluene;2-tritiopropanoic acid.
Molecular Properties
| Compound Name | toluene;2-tritiopropanoic acid |
| PubChem CID | 161222842 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 168.23 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | toluene;2-tritiopropanoic acid |
| SMILES | Cc1ccccc1.[3H]C(C)C(=O)O |
| InChI | InChI=1S/C7H8.C3H6O2/c1-7-5-3-2-4-6-7;1-2-3(4)5/h2-6H,1H3;2H2,1H3,(H,4,5)/i;2T |
| InChIKey | UXSZWPCJYFEYRW-IIVVCMKJSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze toluene;2-tritiopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of toluene;2-tritiopropanoic acid?
The IUPAC name of toluene;2-tritiopropanoic acid (CID 161222842) is toluene;2-tritiopropanoic acid.
What is the SMILES notation for toluene;2-tritiopropanoic acid?
The canonical SMILES for toluene;2-tritiopropanoic acid is Cc1ccccc1.[3H]C(C)C(=O)O.
What is the InChIKey of toluene;2-tritiopropanoic acid?
The InChIKey is UXSZWPCJYFEYRW-IIVVCMKJSA-N. The full InChI is InChI=1S/C7H8.C3H6O2/c1-7-5-3-2-4-6-7;1-2-3(4)5/h2-6H,1H3;2H2,1H3,(H,4,5)/i;2T.
What are the key properties of toluene;2-tritiopropanoic acid?
toluene;2-tritiopropanoic acid has a molecular weight of 168.23 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for toluene;2-tritiopropanoic acid is sourced from PubChem (CID 161222842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).