C30H31N2O+ — CID 135979530
N-[(1E,3E,5E)-6-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hexa-1,3,5-trienyl]-N-phenylacetamide (PubChem CID 135979530) has the molecular formula C30H31N2O+ and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[(1E,3E,5E)-6-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hexa-1,3,5-trienyl]-N-phenylacetamide.
| Compound Name | N-[(1E,3E,5E)-6-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hexa-1,3,5-trienyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135979530 |
| Molecular Formula | C30H31N2O+ |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[(1E,3E,5E)-6-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)hexa-1,3,5-trienyl]-N-phenylacetamide |
| SMILES | CC[N+]1=C(/C=C/C=C/C=C/N(C(C)=O)c2ccccc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C30H31N2O/c1-5-31-27-21-20-24-15-12-13-18-26(24)29(27)30(3,4)28(31)19-11-6-7-14-22-32(23(2)33)25-16-9-8-10-17-25/h6-22H,5H2,1-4H3/q+1 |
| InChIKey | FUTCGJCGXABNAU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|