C35H34NNd- — CID 153394178
3-ethyl-1,1-dimethyl-2-[(1E,3E)-7-methyl-7-(2H-naphthalen-2-id-1-yl)octa-1,3,5-trienyl]benzo[e]indol-3-ium;neodymium (PubChem CID 153394178) has the molecular formula C35H34NNd- and a molecular weight of 612.90 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-2-[(1E,3E)-7-methyl-7-(2H-naphthalen-2-id-1-yl)octa-1,3,5-trienyl]benzo[e]indol-3-ium;neodymium.
| Compound Name | 3-ethyl-1,1-dimethyl-2-[(1E,3E)-7-methyl-7-(2H-naphthalen-2-id-1-yl)octa-1,3,5-trienyl]benzo[e]indol-3-ium;neodymium |
|---|---|
| PubChem CID | 153394178 |
| Molecular Formula | C35H34NNd- |
| Molecular Weight | 612.90 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-2-[(1E,3E)-7-methyl-7-(2H-naphthalen-2-id-1-yl)octa-1,3,5-trienyl]benzo[e]indol-3-ium;neodymium |
| SMILES | CC[N+]1=C(/C=C/C=C/C=[C-]/C(C)(C)c2[c-]ccc3ccccc23)C(C)(C)c2c1ccc1ccccc21.[Nd] |
| InChI | InChI=1S/C35H34N.Nd/c1-6-36-31-24-23-27-17-11-13-20-29(27)33(31)35(4,5)32(36)22-9-7-8-14-25-34(2,3)30-21-15-18-26-16-10-12-19-28(26)30;/h7-20,22-24H,6H2,1-5H3;/q-1;/b8-7+,22-9+; |
| InChIKey | HHULXNDLMALNJT-LBNMIHITSA-N |
| XLogP | 8.64 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.90 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|