C28H29N2O+ — CID 136645914
N-[(1E,3E)-4-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide (PubChem CID 136645914) has the molecular formula C28H29N2O+ and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[(1E,3E)-4-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide.
| Compound Name | N-[(1E,3E)-4-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 136645914 |
| Molecular Formula | C28H29N2O+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[(1E,3E)-4-(3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
| SMILES | CC[N+]1=C(/C=C/C=C/N(C(C)=O)c2ccccc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C28H29N2O/c1-5-29-25-19-18-22-13-9-10-16-24(22)27(25)28(3,4)26(29)17-11-12-20-30(21(2)31)23-14-7-6-8-15-23/h6-20H,5H2,1-4H3/q+1 |
| InChIKey | OTGRCPTVMCRAGD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|