C48H25N2O+ — CID 135984666
N-[(1E,3E)-4-(3-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide (PubChem CID 135984666) has the molecular formula C48H25N2O+ and a molecular weight of 645.74 g/mol. Its IUPAC name is N-[(1E,3E)-4-(3-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide.
| Compound Name | N-[(1E,3E)-4-(3-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135984666 |
| Molecular Formula | C48H25N2O+ |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | N-[(1E,3E)-4-(3-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)buta-1,3-dienyl]-N-phenylacetamide |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C[N+]1=C(/C=C/C=C/N(C(C)=O)c2ccccc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C48H25N2O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-30-40-50-45-38-37-42-32-27-28-35-44(42)47(45)48(3,4)46(50)36-29-31-39-49(41(2)51)43-33-25-24-26-34-43/h1,24-29,31-39H,2-4H3/q+1 |
| InChIKey | ONSUNWWTWHOWSM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|