C37H35N2+ — CID 97102611
(2Z)-2-[(2Z,4Z)-5-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-1-phenylindole (PubChem CID 97102611) has the molecular formula C37H35N2+ and a molecular weight of 507.70 g/mol. Its IUPAC name is (2Z)-2-[(2Z,4Z)-5-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-1-phenylindole.
| Compound Name | (2Z)-2-[(2Z,4Z)-5-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-1-phenylindole |
|---|---|
| PubChem CID | 97102611 |
| Molecular Formula | C37H35N2+ |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2Z)-2-[(2Z,4Z)-5-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-1-phenylindole |
| SMILES | CC1(C)C(/C=C\C=C/C=C2\N(c3ccccc3)c3ccccc3C2(C)C)=[N+](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C37H35N2/c1-36(2)30-22-14-16-24-32(30)38(28-18-8-5-9-19-28)34(36)26-12-7-13-27-35-37(3,4)31-23-15-17-25-33(31)39(35)29-20-10-6-11-21-29/h5-27H,1-4H3/q+1 |
| InChIKey | FXSODIIGFDXMTB-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|