C41H45NO6S — CID 118504812
(E,9E)-9-(9-ethyl-6,8,8-trimethyl-2-phenylpyrano[3,2-g]quinolin-4-ylidene)-5-methyl-6-methylidene-5-(2-methyl-5-sulfophenyl)non-7-enoic acid (PubChem CID 118504812) has the molecular formula C41H45NO6S and a molecular weight of 679.88 g/mol. Its IUPAC name is (E,9E)-9-(9-ethyl-6,8,8-trimethyl-2-phenylpyrano[3,2-g]quinolin-4-ylidene)-5-methyl-6-methylidene-5-(2-methyl-5-sulfophenyl)non-7-enoic acid.
| Compound Name | (E,9E)-9-(9-ethyl-6,8,8-trimethyl-2-phenylpyrano[3,2-g]quinolin-4-ylidene)-5-methyl-6-methylidene-5-(2-methyl-5-sulfophenyl)non-7-enoic acid |
|---|---|
| PubChem CID | 118504812 |
| Molecular Formula | C41H45NO6S |
| Molecular Weight | 679.88 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | (E,9E)-9-(9-ethyl-6,8,8-trimethyl-2-phenylpyrano[3,2-g]quinolin-4-ylidene)-5-methyl-6-methylidene-5-(2-methyl-5-sulfophenyl)non-7-enoic acid |
| SMILES | C=C(/C=C/C=C1\C=C(c2ccccc2)Oc2cc3c(cc21)C(C)=CC(C)(C)N3CC)C(C)(CCCC(=O)O)c1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C41H45NO6S/c1-8-42-36-25-38-34(24-33(36)28(3)26-40(42,5)6)31(22-37(48-38)30-15-10-9-11-16-30)17-12-14-29(4)41(7,21-13-18-39(43)44)35-23-32(49(45,46)47)20-19-27(35)2/h9-12,14-17,19-20,22-26H,4,8,13,18,21H2,1-3,5-7H3,(H,43,44)(H,45,46,47)/b14-12+,31-17+ |
| InChIKey | UHABRJHJGZWRAE-OSBMDHLSSA-N |
| XLogP | 9.41 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.88 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|