C44H57N2O7S+ — CID 123404688
6-[2-[5-(2-tert-butyl-9-ethyl-6,8,8-trimethylpyrano[3,2-g]quinolin-4-ylidene)penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 123404688) has the molecular formula C44H57N2O7S+ and a molecular weight of 758.01 g/mol. Its IUPAC name is 6-[2-[5-(2-tert-butyl-9-ethyl-6,8,8-trimethylpyrano[3,2-g]quinolin-4-ylidene)penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[5-(2-tert-butyl-9-ethyl-6,8,8-trimethylpyrano[3,2-g]quinolin-4-ylidene)penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 123404688 |
| Molecular Formula | C44H57N2O7S+ |
| Molecular Weight | 758.01 g/mol |
| Exact Mass | 757.39 |
| IUPAC Name | 6-[2-[5-(2-tert-butyl-9-ethyl-6,8,8-trimethylpyrano[3,2-g]quinolin-4-ylidene)penta-1,3-dienyl]-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(=CC=CC=CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)CCOC)C=C(C(C)(C)C)O3 |
| InChI | InChI=1S/C44H56N2O7S/c1-10-46-37-28-38-34(27-33(37)30(2)29-43(46,6)7)31(25-40(53-38)42(3,4)5)17-13-11-14-18-39-44(8,22-24-52-9)35-26-32(54(49,50)51)20-21-36(35)45(39)23-16-12-15-19-41(47)48/h11,13-14,17-18,20-21,25-29H,10,12,15-16,19,22-24H2,1-9H3,(H-,47,48,49,50,51)/p+1 |
| InChIKey | IIYXCEYQVJRRBY-UHFFFAOYSA-O |
| XLogP | 9.51 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.01 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|