C23H30N3O4S+ — CID 87599612
4-[2-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 87599612) has the molecular formula C23H30N3O4S+ and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-[2-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87599612 |
| Molecular Formula | C23H30N3O4S+ |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[2-[(E)-[(4-methoxyphenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc(N(C)/N=C/C2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-23(2)20-9-5-6-10-21(20)26(15-7-8-16-31(27,28)29)22(23)17-24-25(3)18-11-13-19(30-4)14-12-18/h5-6,9-14,17H,7-8,15-16H2,1-4H3/p+1 |
| InChIKey | FQITWEXMPJDUGD-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|