C22H25ClN3O+ — CID 59111022
4-[2-[[(4-chlorophenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butan-2-one (PubChem CID 59111022) has the molecular formula C22H25ClN3O+ and a molecular weight of 382.92 g/mol. Its IUPAC name is 4-[2-[[(4-chlorophenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butan-2-one.
| Compound Name | 4-[2-[[(4-chlorophenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butan-2-one |
|---|---|
| PubChem CID | 59111022 |
| Molecular Formula | C22H25ClN3O+ |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[2-[[(4-chlorophenyl)-methylhydrazinylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]butan-2-one |
| SMILES | CC(=O)CC[N+]1=C(C=NN(C)c2ccc(Cl)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H25ClN3O/c1-16(27)13-14-26-20-8-6-5-7-19(20)22(2,3)21(26)15-24-25(4)18-11-9-17(23)10-12-18/h5-12,15H,13-14H2,1-4H3/q+1 |
| InChIKey | OJRYIJNAJPXOCC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|