C22H28N3O+ — CID 20599357
N-methyl-2-propoxy-N-[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]aniline (PubChem CID 20599357) has the molecular formula C22H28N3O+ and a molecular weight of 350.49 g/mol. Its IUPAC name is N-methyl-2-propoxy-N-[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]aniline.
| Compound Name | N-methyl-2-propoxy-N-[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 20599357 |
| Molecular Formula | C22H28N3O+ |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-methyl-2-propoxy-N-[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]aniline |
| SMILES | CCCOc1ccccc1N(C)/N=C/C1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H28N3O/c1-6-15-26-20-14-10-9-13-19(20)25(5)23-16-21-22(2,3)17-11-7-8-12-18(17)24(21)4/h7-14,16H,6,15H2,1-5H3/q+1 |
| InChIKey | MREXRLSSJYCYHQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 27.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|