About potassium 2-propoxyphenolate
potassium 2-propoxyphenolate (PubChem CID 23686802) has the molecular formula C9H11KO2
and a molecular weight of 190.28 g/mol. Its IUPAC name is potassium 2-propoxyphenolate.
Molecular Properties
| Compound Name | potassium 2-propoxyphenolate |
| PubChem CID | 23686802 |
| Molecular Formula | C9H11KO2 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | potassium 2-propoxyphenolate |
| SMILES | CCCOc1ccccc1[O-].[K+] |
| InChI | InChI=1S/C9H12O2.K/c1-2-7-11-9-6-4-3-5-8(9)10;/h3-6,10H,2,7H2,1H3;/q;+1/p-1 |
| InChIKey | ASPXHNUXXGHCGZ-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 2-propoxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-propoxyphenolate?
The IUPAC name of potassium 2-propoxyphenolate (CID 23686802) is potassium 2-propoxyphenolate.
What is the SMILES notation for potassium 2-propoxyphenolate?
The canonical SMILES for potassium 2-propoxyphenolate is CCCOc1ccccc1[O-].[K+].
What is the InChIKey of potassium 2-propoxyphenolate?
The InChIKey is ASPXHNUXXGHCGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O2.K/c1-2-7-11-9-6-4-3-5-8(9)10;/h3-6,10H,2,7H2,1H3;/q;+1/p-1.
What are the key properties of potassium 2-propoxyphenolate?
potassium 2-propoxyphenolate has a molecular weight of 190.28 g/mol, XLogP of -1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-propoxyphenolate is sourced from PubChem (CID 23686802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).